C27H29NO5S — CID 162460213
N-[4-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]benzenesulfonamide (PubChem CID 162460213) has the molecular formula C27H29NO5S and a molecular weight of 479.60 g/mol. Its IUPAC name is N-[4-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162460213 |
| Molecular Formula | C27H29NO5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-[4-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]benzenesulfonamide |
| SMILES | O=c1oc2c(c(O)c1C(c1ccc(NS(=O)(=O)c3ccccc3)cc1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C27H29NO5S/c29-26-22-10-6-1-2-7-11-23(22)33-27(30)25(26)24(18-12-13-18)19-14-16-20(17-15-19)28-34(31,32)21-8-4-3-5-9-21/h3-5,8-9,14-18,24,28-29H,1-2,6-7,10-13H2 |
| InChIKey | OTTNBTKDXAZMMN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |