C27H27Cl2NO5S — CID 54688960
2,4-dichloro-N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]benzenesulfonamide (PubChem CID 54688960) has the molecular formula C27H27Cl2NO5S and a molecular weight of 548.49 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54688960 |
| Molecular Formula | C27H27Cl2NO5S |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 2,4-dichloro-N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]benzenesulfonamide |
| SMILES | O=c1oc2c(c(O)c1C(c1cccc(NS(=O)(=O)c3ccc(Cl)cc3Cl)c1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C27H27Cl2NO5S/c28-18-12-13-23(21(29)15-18)36(33,34)30-19-7-5-6-17(14-19)24(16-10-11-16)25-26(31)20-8-3-1-2-4-9-22(20)35-27(25)32/h5-7,12-16,24,30-31H,1-4,8-11H2 |
| InChIKey | ZZQLQBPBXFMGET-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |