C30H30N2O5S2 — CID 54724870
N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-5-pyridin-2-ylthiophene-2-sulfonamide (PubChem CID 54724870) has the molecular formula C30H30N2O5S2 and a molecular weight of 562.71 g/mol. Its IUPAC name is N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-5-pyridin-2-ylthiophene-2-sulfonamide.
| Compound Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54724870 |
| Molecular Formula | C30H30N2O5S2 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-5-pyridin-2-ylthiophene-2-sulfonamide |
| SMILES | O=c1oc2c(c(O)c1C(c1cccc(NS(=O)(=O)c3ccc(-c4ccccn4)s3)c1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C30H30N2O5S2/c33-29-22-10-3-1-2-4-12-24(22)37-30(34)28(29)27(19-13-14-19)20-8-7-9-21(18-20)32-39(35,36)26-16-15-25(38-26)23-11-5-6-17-31-23/h5-9,11,15-19,27,32-33H,1-4,10,12-14H2 |
| InChIKey | NEPMSHTYELASRH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |