C25H25Cl2NO5S2 — CID 54724845
2,5-dichloro-N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]thiophene-3-sulfonamide (PubChem CID 54724845) has the molecular formula C25H25Cl2NO5S2 and a molecular weight of 554.52 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 54724845 |
| Molecular Formula | C25H25Cl2NO5S2 |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | 2,5-dichloro-N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]thiophene-3-sulfonamide |
| SMILES | O=c1oc2c(c(O)c1C(c1cccc(NS(=O)(=O)c3cc(Cl)sc3Cl)c1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C25H25Cl2NO5S2/c26-20-13-19(24(27)34-20)35(31,32)28-16-7-5-6-15(12-16)21(14-10-11-14)22-23(29)17-8-3-1-2-4-9-18(17)33-25(22)30/h5-7,12-14,21,28-29H,1-4,8-11H2 |
| InChIKey | MARSRHAAAHAPES-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |