C27H27N3O6S — CID 54724854
N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 54724854) has the molecular formula C27H27N3O6S and a molecular weight of 521.60 g/mol. Its IUPAC name is N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 54724854 |
| Molecular Formula | C27H27N3O6S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | N-[3-[cyclopropyl-(4-hydroxy-2-oxo-5,6,7,8,9,10-hexahydrocycloocta[b]pyran-3-yl)methyl]phenyl]-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | O=c1oc2c(c(O)c1C(c1cccc(NS(=O)(=O)c3cccc4nonc34)c1)C1CC1)CCCCCC2 |
| InChI | InChI=1S/C27H27N3O6S/c31-26-19-9-3-1-2-4-11-21(19)35-27(32)24(26)23(16-13-14-16)17-7-5-8-18(15-17)30-37(33,34)22-12-6-10-20-25(22)29-36-28-20/h5-8,10,12,15-16,23,30-31H,1-4,9,11,13-14H2 |
| InChIKey | CEYCRYNYNILQDW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|