C51H92O8 — CID 162463094
10-[1,3-bis[[(Z)-octadec-9-enoyl]oxy]propan-2-yloxy]-3,8-dimethyl-10-oxodecanoic acid (PubChem CID 162463094) has the molecular formula C51H92O8 and a molecular weight of 833.29 g/mol. Its IUPAC name is 10-[1,3-bis[[(Z)-octadec-9-enoyl]oxy]propan-2-yloxy]-3,8-dimethyl-10-oxodecanoic acid.
| Compound Name | 10-[1,3-bis[[(Z)-octadec-9-enoyl]oxy]propan-2-yloxy]-3,8-dimethyl-10-oxodecanoic acid |
|---|---|
| PubChem CID | 162463094 |
| Molecular Formula | C51H92O8 |
| Molecular Weight | 833.29 g/mol |
| Exact Mass | 832.68 |
| IUPAC Name | 10-[1,3-bis[[(Z)-octadec-9-enoyl]oxy]propan-2-yloxy]-3,8-dimethyl-10-oxodecanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CC(C)CCCCC(C)CC(=O)O |
| InChI | InChI=1S/C51H92O8/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39-49(54)57-43-47(59-51(56)42-46(4)38-36-35-37-45(3)41-48(52)53)44-58-50(55)40-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,45-47H,5-18,23-44H2,1-4H3,(H,52,53)/b21-19-,22-20- |
| InChIKey | SGCNRSZBDQYGBE-WRBBJXAJSA-N |
| XLogP | 14.76 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.29 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|