C33H31IrN4 — CID 162463185
3,5-dimethyl-1-phenylpyrazole;iridium(3+);1-methyl-3-[4-(4-phenylphenyl)benzene-6-id-1-yl]imidazolidin-2-ide (PubChem CID 162463185) has the molecular formula C33H31IrN4 and a molecular weight of 675.86 g/mol. Its IUPAC name is 3,5-dimethyl-1-phenylpyrazole;iridium(3+);1-methyl-3-[4-(4-phenylphenyl)benzene-6-id-1-yl]imidazolidin-2-ide.
| Compound Name | 3,5-dimethyl-1-phenylpyrazole;iridium(3+);1-methyl-3-[4-(4-phenylphenyl)benzene-6-id-1-yl]imidazolidin-2-ide |
|---|---|
| PubChem CID | 162463185 |
| Molecular Formula | C33H31IrN4 |
| Molecular Weight | 675.86 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | 3,5-dimethyl-1-phenylpyrazole;iridium(3+);1-methyl-3-[4-(4-phenylphenyl)benzene-6-id-1-yl]imidazolidin-2-ide |
| SMILES | CN1[CH-]N(c2[c-]cc(-c3ccc(-c4ccccc4)cc3)cc2)CC1.Cc1cc(C)n(-c2[c-]cccc2)n1.[Ir+3] |
| InChI | InChI=1S/C22H20N2.C11H11N2.Ir/c1-23-15-16-24(17-23)22-13-11-21(12-14-22)20-9-7-19(8-10-20)18-5-3-2-4-6-18;1-9-8-10(2)13(12-9)11-6-4-3-5-7-11;/h2-13,17H,15-16H2,1H3;3-6,8H,1-2H3;/q-2;-1;+3 |
| InChIKey | QHZIBCOHXYCSEC-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.86 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|