C34H35IrN6O — CID 59661599
bis(1,5-dimethyl-4-phenylimidazole);iridium(3+);1-(2-methoxybenzene-6-id-1-yl)-3,5-dimethylpyrazole (PubChem CID 59661599) has the molecular formula C34H35IrN6O and a molecular weight of 735.91 g/mol. Its IUPAC name is bis(1,5-dimethyl-4-phenylimidazole);iridium(3+);1-(2-methoxybenzene-6-id-1-yl)-3,5-dimethylpyrazole.
| Compound Name | bis(1,5-dimethyl-4-phenylimidazole);iridium(3+);1-(2-methoxybenzene-6-id-1-yl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 59661599 |
| Molecular Formula | C34H35IrN6O |
| Molecular Weight | 735.91 g/mol |
| Exact Mass | 736.25 |
| IUPAC Name | bis(1,5-dimethyl-4-phenylimidazole);iridium(3+);1-(2-methoxybenzene-6-id-1-yl)-3,5-dimethylpyrazole |
| SMILES | COc1ccc[c-]c1-n1nc(C)cc1C.Cc1c(-c2[c-]cccc2)ncn1C.Cc1c(-c2[c-]cccc2)ncn1C.[Ir+3] |
| InChI | InChI=1S/C12H13N2O.2C11H11N2.Ir/c1-9-8-10(2)14(13-9)11-6-4-5-7-12(11)15-3;2*1-9-11(12-8-13(9)2)10-6-4-3-5-7-10;/h4-5,7-8H,1-3H3;2*3-6,8H,1-2H3;/q3*-1;+3 |
| InChIKey | OUUFFZSIXKNDKO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 62.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.91 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|