About 2,6-dibromo-4-nitro-1,3-azaborinine
2,6-dibromo-4-nitro-1,3-azaborinine (PubChem CID 162468437) has the molecular formula C4HBBr2N2O2
and a molecular weight of 279.68 g/mol. Its IUPAC name is 2,6-dibromo-4-nitro-1,3-azaborinine.
Molecular Properties
| Compound Name | 2,6-dibromo-4-nitro-1,3-azaborinine |
| PubChem CID | 162468437 |
| Molecular Formula | C4HBBr2N2O2 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 277.85 |
| IUPAC Name | 2,6-dibromo-4-nitro-1,3-azaborinine |
| SMILES | O=[N+]([O-])c1bc(Br)nc(Br)c1 |
| InChI | InChI=1S/C4HBBr2N2O2/c6-3-1-2(9(10)11)5-4(7)8-3/h1H |
| InChIKey | MPWDQDYMNRQRNN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibromo-4-nitro-1,3-azaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-nitro-1,3-azaborinine?
The IUPAC name of 2,6-dibromo-4-nitro-1,3-azaborinine (CID 162468437) is 2,6-dibromo-4-nitro-1,3-azaborinine.
What is the SMILES notation for 2,6-dibromo-4-nitro-1,3-azaborinine?
The canonical SMILES for 2,6-dibromo-4-nitro-1,3-azaborinine is O=[N+]([O-])c1bc(Br)nc(Br)c1.
What is the InChIKey of 2,6-dibromo-4-nitro-1,3-azaborinine?
The InChIKey is MPWDQDYMNRQRNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HBBr2N2O2/c6-3-1-2(9(10)11)5-4(7)8-3/h1H.
What are the key properties of 2,6-dibromo-4-nitro-1,3-azaborinine?
2,6-dibromo-4-nitro-1,3-azaborinine has a molecular weight of 279.68 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-nitro-1,3-azaborinine is sourced from PubChem (CID 162468437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).