C4HBBr2N2O2 — CID 162468437
2,6-dibromo-4-nitro-1,3-azaborinine (PubChem CID 162468437) has the molecular formula C4HBBr2N2O2 and a molecular weight of 279.68 g/mol. Its IUPAC name is 2,6-dibromo-4-nitro-1,3-azaborinine.
| Compound Name | 2,6-dibromo-4-nitro-1,3-azaborinine |
|---|---|
| PubChem CID | 162468437 |
| Molecular Formula | C4HBBr2N2O2 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 277.85 |
| IUPAC Name | 2,6-dibromo-4-nitro-1,3-azaborinine |
| SMILES | O=[N+]([O-])c1bc(Br)nc(Br)c1 |
| InChI | InChI=1S/C4HBBr2N2O2/c6-3-1-2(9(10)11)5-4(7)8-3/h1H |
| InChIKey | MPWDQDYMNRQRNN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|