C12H23N — CID 162470780
N,2-di(propan-2-yl)cyclohexan-1-imine (PubChem CID 162470780) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N,2-di(propan-2-yl)cyclohexan-1-imine.
| Compound Name | N,2-di(propan-2-yl)cyclohexan-1-imine |
|---|---|
| PubChem CID | 162470780 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N,2-di(propan-2-yl)cyclohexan-1-imine |
| SMILES | CC(C)/N=C1\CCCCC1C(C)C |
| InChI | InChI=1S/C12H23N/c1-9(2)11-7-5-6-8-12(11)13-10(3)4/h9-11H,5-8H2,1-4H3/b13-12+ |
| InChIKey | PJSQQHSGTJNLFG-OUKQBFOZSA-N |
| XLogP | 3.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|