C11H21NO — CID 125476424
(Z,2R)-2-methyl-N-(2-methylpropoxy)cyclohexan-1-imine (PubChem CID 125476424) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (Z,2R)-2-methyl-N-(2-methylpropoxy)cyclohexan-1-imine.
| Compound Name | (Z,2R)-2-methyl-N-(2-methylpropoxy)cyclohexan-1-imine |
|---|---|
| PubChem CID | 125476424 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (Z,2R)-2-methyl-N-(2-methylpropoxy)cyclohexan-1-imine |
| SMILES | CC(C)CO/N=C1/CCCC[C@H]1C |
| InChI | InChI=1S/C11H21NO/c1-9(2)8-13-12-11-7-5-4-6-10(11)3/h9-10H,4-8H2,1-3H3/b12-11-/t10-/m1/s1 |
| InChIKey | HHYPTZHPRVKJQU-ZOAHYWAASA-N |
| XLogP | 3.23 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|