C9H17NO — CID 125476420
(Z,2R)-N-ethoxy-2-methylcyclohexan-1-imine (PubChem CID 125476420) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z,2R)-N-ethoxy-2-methylcyclohexan-1-imine.
| Compound Name | (Z,2R)-N-ethoxy-2-methylcyclohexan-1-imine |
|---|---|
| PubChem CID | 125476420 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (Z,2R)-N-ethoxy-2-methylcyclohexan-1-imine |
| SMILES | CCO/N=C1/CCCC[C@H]1C |
| InChI | InChI=1S/C9H17NO/c1-3-11-10-9-7-5-4-6-8(9)2/h8H,3-7H2,1-2H3/b10-9-/t8-/m1/s1 |
| InChIKey | GGQKFLMCEPFDOT-SREPSJJZSA-N |
| XLogP | 2.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|