About 2-methylcyclohexan-1-one;methyl formate
2-methylcyclohexan-1-one;methyl formate (PubChem CID 174899830) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-methylcyclohexan-1-one;methyl formate.
Molecular Properties
| Compound Name | 2-methylcyclohexan-1-one;methyl formate |
| PubChem CID | 174899830 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-methylcyclohexan-1-one;methyl formate |
| SMILES | CC1CCCCC1=O.COC=O |
| InChI | InChI=1S/C7H12O.C2H4O2/c1-6-4-2-3-5-7(6)8;1-4-2-3/h6H,2-5H2,1H3;2H,1H3 |
| InChIKey | YHVISNFCDWAFNV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylcyclohexan-1-one;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylcyclohexan-1-one;methyl formate?
The IUPAC name of 2-methylcyclohexan-1-one;methyl formate (CID 174899830) is 2-methylcyclohexan-1-one;methyl formate.
What is the SMILES notation for 2-methylcyclohexan-1-one;methyl formate?
The canonical SMILES for 2-methylcyclohexan-1-one;methyl formate is CC1CCCCC1=O.COC=O.
What is the InChIKey of 2-methylcyclohexan-1-one;methyl formate?
The InChIKey is YHVISNFCDWAFNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C2H4O2/c1-6-4-2-3-5-7(6)8;1-4-2-3/h6H,2-5H2,1H3;2H,1H3.
What are the key properties of 2-methylcyclohexan-1-one;methyl formate?
2-methylcyclohexan-1-one;methyl formate has a molecular weight of 172.22 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylcyclohexan-1-one;methyl formate is sourced from PubChem (CID 174899830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).