About ethyl formate;2-methylcyclohexan-1-one
ethyl formate;2-methylcyclohexan-1-one (PubChem CID 174850606) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is ethyl formate;2-methylcyclohexan-1-one.
Molecular Properties
| Compound Name | ethyl formate;2-methylcyclohexan-1-one |
| PubChem CID | 174850606 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | ethyl formate;2-methylcyclohexan-1-one |
| SMILES | CC1CCCCC1=O.CCOC=O |
| InChI | InChI=1S/C7H12O.C3H6O2/c1-6-4-2-3-5-7(6)8;1-2-5-3-4/h6H,2-5H2,1H3;3H,2H2,1H3 |
| InChIKey | OMRUTDXXEULPNB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;2-methylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;2-methylcyclohexan-1-one?
The IUPAC name of ethyl formate;2-methylcyclohexan-1-one (CID 174850606) is ethyl formate;2-methylcyclohexan-1-one.
What is the SMILES notation for ethyl formate;2-methylcyclohexan-1-one?
The canonical SMILES for ethyl formate;2-methylcyclohexan-1-one is CC1CCCCC1=O.CCOC=O.
What is the InChIKey of ethyl formate;2-methylcyclohexan-1-one?
The InChIKey is OMRUTDXXEULPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C3H6O2/c1-6-4-2-3-5-7(6)8;1-2-5-3-4/h6H,2-5H2,1H3;3H,2H2,1H3.
What are the key properties of ethyl formate;2-methylcyclohexan-1-one?
ethyl formate;2-methylcyclohexan-1-one has a molecular weight of 186.25 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;2-methylcyclohexan-1-one is sourced from PubChem (CID 174850606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).