C17H8Br2N4 — CID 162470923
16,18-dibromo-6,12,14,21-tetrazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15(20),16,18-decaene (PubChem CID 162470923) has the molecular formula C17H8Br2N4 and a molecular weight of 428.09 g/mol. Its IUPAC name is 16,18-dibromo-6,12,14,21-tetrazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15(20),16,18-decaene.
| Compound Name | 16,18-dibromo-6,12,14,21-tetrazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15(20),16,18-decaene |
|---|---|
| PubChem CID | 162470923 |
| Molecular Formula | C17H8Br2N4 |
| Molecular Weight | 428.09 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | 16,18-dibromo-6,12,14,21-tetrazapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(21),2(7),3,5,8(13),9,11,15(20),16,18-decaene |
| SMILES | Brc1cc(Br)c2c(c1)nc1c3cccnc3c3cccnc3n12 |
| InChI | InChI=1S/C17H8Br2N4/c18-9-7-12(19)15-13(8-9)22-17-11-4-1-5-20-14(11)10-3-2-6-21-16(10)23(15)17/h1-8H |
| InChIKey | HXDWFKDBAPHHEU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.09 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|