C17H30N5O4+ — CID 162471982
[5-(methylamino)-6-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]-(2-oxopropyl)amino]hexyl]azanium (PubChem CID 162471982) has the molecular formula C17H30N5O4+ and a molecular weight of 368.46 g/mol. Its IUPAC name is [5-(methylamino)-6-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]-(2-oxopropyl)amino]hexyl]azanium.
| Compound Name | [5-(methylamino)-6-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]-(2-oxopropyl)amino]hexyl]azanium |
|---|---|
| PubChem CID | 162471982 |
| Molecular Formula | C17H30N5O4+ |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | [5-(methylamino)-6-[[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]-(2-oxopropyl)amino]hexyl]azanium |
| SMILES | CNC(CCCC[NH3+])CN(CC(C)=O)C(=O)Cn1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H29N5O4/c1-12-8-22(17(26)20-16(12)25)11-15(24)21(9-13(2)23)10-14(19-3)6-4-5-7-18/h8,14,19H,4-7,9-11,18H2,1-3H3,(H,20,25,26)/p+1 |
| InChIKey | RPDPGHYECJXYCY-UHFFFAOYSA-O |
| XLogP | -1.74 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|