C47H29F3N4O4S2 — CID 162473441
[7-[3-[[1]benzofuro[2,3-b]pyridin-3-yl(pyridin-4-yl)amino]phenyl]-1-(N-phenylanilino)dibenzothiophen-3-yl] trifluoromethanesulfonate (PubChem CID 162473441) has the molecular formula C47H29F3N4O4S2 and a molecular weight of 834.90 g/mol. Its IUPAC name is [7-[3-[[1]benzofuro[2,3-b]pyridin-3-yl(pyridin-4-yl)amino]phenyl]-1-(N-phenylanilino)dibenzothiophen-3-yl] trifluoromethanesulfonate.
| Compound Name | [7-[3-[[1]benzofuro[2,3-b]pyridin-3-yl(pyridin-4-yl)amino]phenyl]-1-(N-phenylanilino)dibenzothiophen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162473441 |
| Molecular Formula | C47H29F3N4O4S2 |
| Molecular Weight | 834.90 g/mol |
| Exact Mass | 834.16 |
| IUPAC Name | [7-[3-[[1]benzofuro[2,3-b]pyridin-3-yl(pyridin-4-yl)amino]phenyl]-1-(N-phenylanilino)dibenzothiophen-3-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccccc2)c2c(c1)sc1cc(-c3cccc(N(c4ccncc4)c4cnc5oc6ccccc6c5c4)c3)ccc12)C(F)(F)F |
| InChI | InChI=1S/C47H29F3N4O4S2/c48-47(49,50)60(55,56)58-37-27-41(54(32-11-3-1-4-12-32)33-13-5-2-6-14-33)45-39-19-18-31(25-43(39)59-44(45)28-37)30-10-9-15-35(24-30)53(34-20-22-51-23-21-34)36-26-40-38-16-7-8-17-42(38)57-46(40)52-29-36/h1-29H |
| InChIKey | MTACRBQRDHPHDR-UHFFFAOYSA-N |
| XLogP | 13.58 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.90 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|