C59H36F3N5O4S2 — CID 157482738
[8-[3-[[1]benzofuro[2,3-b]pyridin-3-yl(pyridin-3-yl)amino]phenyl]-4-(N-(9-phenylcarbazol-2-yl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate (PubChem CID 157482738) has the molecular formula C59H36F3N5O4S2 and a molecular weight of 1000.10 g/mol. Its IUPAC name is [8-[3-[[1]benzofuro[2,3-b]pyridin-3-yl(pyridin-3-yl)amino]phenyl]-4-(N-(9-phenylcarbazol-2-yl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-[3-[[1]benzofuro[2,3-b]pyridin-3-yl(pyridin-3-yl)amino]phenyl]-4-(N-(9-phenylcarbazol-2-yl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 157482738 |
| Molecular Formula | C59H36F3N5O4S2 |
| Molecular Weight | 1000.10 g/mol |
| Exact Mass | 999.22 |
| IUPAC Name | [8-[3-[[1]benzofuro[2,3-b]pyridin-3-yl(pyridin-3-yl)amino]phenyl]-4-(N-(9-phenylcarbazol-2-yl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc3c4ccccc4n(-c4ccccc4)c3c2)c2sc3ccc(-c4cccc(N(c5cccnc5)c5cnc6oc7ccccc7c6c5)c4)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C59H36F3N5O4S2/c60-59(61,62)73(68,69)71-45-33-50-49-30-38(37-13-11-18-41(29-37)65(43-19-12-28-63-35-43)44-31-51-48-21-8-10-23-55(48)70-58(51)64-36-44)24-27-56(49)72-57(50)54(34-45)66(39-14-3-1-4-15-39)42-25-26-47-46-20-7-9-22-52(46)67(53(47)32-42)40-16-5-2-6-17-40/h1-36H |
| InChIKey | ZNMQKKKKXGNWTQ-UHFFFAOYSA-N |
| XLogP | 16.68 |
| TPSA | 93.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.10 |
| LogP ≤ 5 | 16.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|