C25H22N8O — CID 162474502
N-[2-(1H-indol-3-yl)ethyl]-2-(5-isocyano-3-pyridinyl)-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-amine (PubChem CID 162474502) has the molecular formula C25H22N8O and a molecular weight of 450.51 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-2-(5-isocyano-3-pyridinyl)-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-amine.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-2-(5-isocyano-3-pyridinyl)-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-amine |
|---|---|
| PubChem CID | 162474502 |
| Molecular Formula | C25H22N8O |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-2-(5-isocyano-3-pyridinyl)-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-amine |
| SMILES | [C-]#[N+]c1cncc(-c2nc(NCCc3c[nH]c4ccccc34)c3nc4n(c3n2)C(C)(C)CO4)c1 |
| InChI | InChI=1S/C25H22N8O/c1-25(2)14-34-24-30-20-22(28-9-8-15-12-29-19-7-5-4-6-18(15)19)31-21(32-23(20)33(24)25)16-10-17(26-3)13-27-11-16/h4-7,10-13,29H,8-9,14H2,1-2H3,(H,28,31,32) |
| InChIKey | WHGUGRVACBSPNK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|