C22H21IN6O2 — CID 150914371
4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]-2-pyridin-3-ylphenol (PubChem CID 150914371) has the molecular formula C22H21IN6O2 and a molecular weight of 528.35 g/mol. Its IUPAC name is 4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]-2-pyridin-3-ylphenol.
| Compound Name | 4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]-2-pyridin-3-ylphenol |
|---|---|
| PubChem CID | 150914371 |
| Molecular Formula | C22H21IN6O2 |
| Molecular Weight | 528.35 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]-2-pyridin-3-ylphenol |
| SMILES | CC1(C)COc2nc3c(NCCc4ccc(O)c(-c5cccnc5)c4)nc(I)nc3n21 |
| InChI | InChI=1S/C22H21IN6O2/c1-22(2)12-31-21-26-17-18(27-20(23)28-19(17)29(21)22)25-9-7-13-5-6-16(30)15(10-13)14-4-3-8-24-11-14/h3-6,8,10-11,30H,7,9,12H2,1-2H3,(H,25,27,28) |
| InChIKey | LCRDINFCPKBOEY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|