C25H26IN5O2 — CID 162474533
2-(3-ethylphenyl)-4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]phenol (PubChem CID 162474533) has the molecular formula C25H26IN5O2 and a molecular weight of 555.42 g/mol. Its IUPAC name is 2-(3-ethylphenyl)-4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]phenol.
| Compound Name | 2-(3-ethylphenyl)-4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 162474533 |
| Molecular Formula | C25H26IN5O2 |
| Molecular Weight | 555.42 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | 2-(3-ethylphenyl)-4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]phenol |
| SMILES | CCc1cccc(-c2cc(CCNc3nc(I)nc4c3nc3n4C(C)(C)CO3)ccc2O)c1 |
| InChI | InChI=1S/C25H26IN5O2/c1-4-15-6-5-7-17(12-15)18-13-16(8-9-19(18)32)10-11-27-21-20-22(30-23(26)29-21)31-24(28-20)33-14-25(31,2)3/h5-9,12-13,32H,4,10-11,14H2,1-3H3,(H,27,29,30) |
| InChIKey | WJVHXTLRGRBIQI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|