C24H21IN6O2 — CID 162474487
4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]-2-(4-isocyanophenyl)phenol (PubChem CID 162474487) has the molecular formula C24H21IN6O2 and a molecular weight of 552.38 g/mol. Its IUPAC name is 4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]-2-(4-isocyanophenyl)phenol.
| Compound Name | 4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]-2-(4-isocyanophenyl)phenol |
|---|---|
| PubChem CID | 162474487 |
| Molecular Formula | C24H21IN6O2 |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | 4-[2-[(2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]-2-(4-isocyanophenyl)phenol |
| SMILES | [C-]#[N+]c1ccc(-c2cc(CCNc3nc(I)nc4c3nc3n4C(C)(C)CO3)ccc2O)cc1 |
| InChI | InChI=1S/C24H21IN6O2/c1-24(2)13-33-23-28-19-20(29-22(25)30-21(19)31(23)24)27-11-10-14-4-9-18(32)17(12-14)15-5-7-16(26-3)8-6-15/h4-9,12,32H,10-11,13H2,1-2H3,(H,27,29,30) |
| InChIKey | KRONAYXEIOHMPU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|