C24H23F2N5O2 — CID 166825780
2-(2,3-difluorophenyl)-4-[2-[(2,8,8-trimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]phenol (PubChem CID 166825780) has the molecular formula C24H23F2N5O2 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-4-[2-[(2,8,8-trimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]phenol.
| Compound Name | 2-(2,3-difluorophenyl)-4-[2-[(2,8,8-trimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 166825780 |
| Molecular Formula | C24H23F2N5O2 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 2-(2,3-difluorophenyl)-4-[2-[(2,8,8-trimethyl-7H-purino[8,9-b][1,3]oxazol-4-yl)amino]ethyl]phenol |
| SMILES | Cc1nc(NCCc2ccc(O)c(-c3cccc(F)c3F)c2)c2nc3n(c2n1)C(C)(C)CO3 |
| InChI | InChI=1S/C24H23F2N5O2/c1-13-28-21(20-22(29-13)31-23(30-20)33-12-24(31,2)3)27-10-9-14-7-8-18(32)16(11-14)15-5-4-6-17(25)19(15)26/h4-8,11,32H,9-10,12H2,1-3H3,(H,27,28,29) |
| InChIKey | ZEAXGDOVRGVMQO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |