C7H18NO6SSi- — CID 162475010
3-[methyl(3-trihydroxysilylpropyl)amino]propane-1-sulfonate (PubChem CID 162475010) has the molecular formula C7H18NO6SSi- and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-[methyl(3-trihydroxysilylpropyl)amino]propane-1-sulfonate.
| Compound Name | 3-[methyl(3-trihydroxysilylpropyl)amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 162475010 |
| Molecular Formula | C7H18NO6SSi- |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-[methyl(3-trihydroxysilylpropyl)amino]propane-1-sulfonate |
| SMILES | CN(CCC[Si](O)(O)O)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H19NO6SSi/c1-8(4-2-6-15(9,10)11)5-3-7-16(12,13)14/h12-14H,2-7H2,1H3,(H,9,10,11)/p-1 |
| InChIKey | HZCBQEZZLBVNCA-UHFFFAOYSA-M |
| XLogP | -1.84 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|