C35H41Cl2N5O5S — CID 162476573
2-chloro-N-[4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]phenyl]sulfonyl-4-(ethylamino)-3-methyl-5-nitrobenzamide (PubChem CID 162476573) has the molecular formula C35H41Cl2N5O5S and a molecular weight of 714.72 g/mol. Its IUPAC name is 2-chloro-N-[4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]phenyl]sulfonyl-4-(ethylamino)-3-methyl-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]phenyl]sulfonyl-4-(ethylamino)-3-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 162476573 |
| Molecular Formula | C35H41Cl2N5O5S |
| Molecular Weight | 714.72 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | 2-chloro-N-[4-[4-[[2-(4-chlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]phenyl]sulfonyl-4-(ethylamino)-3-methyl-5-nitrobenzamide |
| SMILES | CCNc1c([N+](=O)[O-])cc(C(=O)NS(=O)(=O)c2ccc(N3CCN(CC4=C(c5ccc(Cl)cc5)CC(C)(C)CC4)CC3)cc2)c(Cl)c1C |
| InChI | InChI=1S/C35H41Cl2N5O5S/c1-5-38-33-23(2)32(37)29(20-31(33)42(44)45)34(43)39-48(46,47)28-12-10-27(11-13-28)41-18-16-40(17-19-41)22-25-14-15-35(3,4)21-30(25)24-6-8-26(36)9-7-24/h6-13,20,38H,5,14-19,21-22H2,1-4H3,(H,39,43) |
| InChIKey | ZSJZMYLAIFFTMK-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.72 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|