C18H22N2O4 — CID 162476844
4-N-(3-hydroxypropyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide (PubChem CID 162476844) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-N-(3-hydroxypropyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide.
| Compound Name | 4-N-(3-hydroxypropyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide |
|---|---|
| PubChem CID | 162476844 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-N-(3-hydroxypropyl)-2-N-methyl-5-[(1S)-1-phenylethyl]furan-2,4-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCCO)c([C@@H](C)c2ccccc2)o1 |
| InChI | InChI=1S/C18H22N2O4/c1-12(13-7-4-3-5-8-13)16-14(17(22)20-9-6-10-21)11-15(24-16)18(23)19-2/h3-5,7-8,11-12,21H,6,9-10H2,1-2H3,(H,19,23)(H,20,22)/t12-/m0/s1 |
| InChIKey | GQYNNDHPFLSGJA-LBPRGKRZSA-N |
| XLogP | 1.90 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|