C18H22N2O3 — CID 146434232
2-N-methyl-5-[(1S)-1-phenylethyl]-4-N-propylfuran-2,4-dicarboxamide (PubChem CID 146434232) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-N-methyl-5-[(1S)-1-phenylethyl]-4-N-propylfuran-2,4-dicarboxamide.
| Compound Name | 2-N-methyl-5-[(1S)-1-phenylethyl]-4-N-propylfuran-2,4-dicarboxamide |
|---|---|
| PubChem CID | 146434232 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-N-methyl-5-[(1S)-1-phenylethyl]-4-N-propylfuran-2,4-dicarboxamide |
| SMILES | CCCNC(=O)c1cc(C(=O)NC)oc1[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3/c1-4-10-20-17(21)14-11-15(18(22)19-3)23-16(14)12(2)13-8-6-5-7-9-13/h5-9,11-12H,4,10H2,1-3H3,(H,19,22)(H,20,21)/t12-/m0/s1 |
| InChIKey | VNJFNJDJIJEBIT-LBPRGKRZSA-N |
| XLogP | 2.93 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |