C23H23NO3 — CID 19938132
2-[bis(4-hydroxyphenyl)methyl]-N-propylbenzamide (PubChem CID 19938132) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is 2-[bis(4-hydroxyphenyl)methyl]-N-propylbenzamide.
| Compound Name | 2-[bis(4-hydroxyphenyl)methyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 19938132 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-[bis(4-hydroxyphenyl)methyl]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccccc1C(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H23NO3/c1-2-15-24-23(27)21-6-4-3-5-20(21)22(16-7-11-18(25)12-8-16)17-9-13-19(26)14-10-17/h3-14,22,25-26H,2,15H2,1H3,(H,24,27) |
| InChIKey | YWXAFWPQEFYREP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|