C27H35FN2O3 — CID 162484467
N-[(4-butoxyphenyl)methyl]-2-[1-[3-(3-fluorophenyl)propanoyl]piperidin-4-yl]acetamide (PubChem CID 162484467) has the molecular formula C27H35FN2O3 and a molecular weight of 454.59 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-[1-[3-(3-fluorophenyl)propanoyl]piperidin-4-yl]acetamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-[1-[3-(3-fluorophenyl)propanoyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 162484467 |
| Molecular Formula | C27H35FN2O3 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-[1-[3-(3-fluorophenyl)propanoyl]piperidin-4-yl]acetamide |
| SMILES | CCCCOc1ccc(CNC(=O)CC2CCN(C(=O)CCc3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C27H35FN2O3/c1-2-3-17-33-25-10-7-23(8-11-25)20-29-26(31)19-22-13-15-30(16-14-22)27(32)12-9-21-5-4-6-24(28)18-21/h4-8,10-11,18,22H,2-3,9,12-17,19-20H2,1H3,(H,29,31) |
| InChIKey | MCTWRNIXKSAGMR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|