C25H32ClN3O3 — CID 52998749
4-[2-[(4-butoxyphenyl)methylamino]-2-oxoethyl]-N-(3-chlorophenyl)piperidine-1-carboxamide (PubChem CID 52998749) has the molecular formula C25H32ClN3O3 and a molecular weight of 458.00 g/mol. Its IUPAC name is 4-[2-[(4-butoxyphenyl)methylamino]-2-oxoethyl]-N-(3-chlorophenyl)piperidine-1-carboxamide.
| Compound Name | 4-[2-[(4-butoxyphenyl)methylamino]-2-oxoethyl]-N-(3-chlorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 52998749 |
| Molecular Formula | C25H32ClN3O3 |
| Molecular Weight | 458.00 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 4-[2-[(4-butoxyphenyl)methylamino]-2-oxoethyl]-N-(3-chlorophenyl)piperidine-1-carboxamide |
| SMILES | CCCCOc1ccc(CNC(=O)CC2CCN(C(=O)Nc3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C25H32ClN3O3/c1-2-3-15-32-23-9-7-20(8-10-23)18-27-24(30)16-19-11-13-29(14-12-19)25(31)28-22-6-4-5-21(26)17-22/h4-10,17,19H,2-3,11-16,18H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | XWIBEDLEQSVBCZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.00 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|