C23H35ClN4O2 — CID 93056112
N-(3-chlorophenyl)-4-[2-[3-[(2R)-2-methylpiperidin-1-yl]propylamino]-2-oxoethyl]piperidine-1-carboxamide (PubChem CID 93056112) has the molecular formula C23H35ClN4O2 and a molecular weight of 435.01 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[2-[3-[(2R)-2-methylpiperidin-1-yl]propylamino]-2-oxoethyl]piperidine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-[2-[3-[(2R)-2-methylpiperidin-1-yl]propylamino]-2-oxoethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 93056112 |
| Molecular Formula | C23H35ClN4O2 |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-(3-chlorophenyl)-4-[2-[3-[(2R)-2-methylpiperidin-1-yl]propylamino]-2-oxoethyl]piperidine-1-carboxamide |
| SMILES | C[C@@H]1CCCCN1CCCNC(=O)CC1CCN(C(=O)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H35ClN4O2/c1-18-6-2-3-12-27(18)13-5-11-25-22(29)16-19-9-14-28(15-10-19)23(30)26-21-8-4-7-20(24)17-21/h4,7-8,17-19H,2-3,5-6,9-16H2,1H3,(H,25,29)(H,26,30)/t18-/m1/s1 |
| InChIKey | UQEBHQFFAGSMHT-GOSISDBHSA-N |
| XLogP | 4.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|