C23H29ClN4O2 — CID 52998743
N-(3-chlorophenyl)-4-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]piperidine-1-carboxamide (PubChem CID 52998743) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]piperidine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 52998743 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-(3-chlorophenyl)-4-[2-[[4-(dimethylamino)phenyl]methylamino]-2-oxoethyl]piperidine-1-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)CC2CCN(C(=O)Nc3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C23H29ClN4O2/c1-27(2)21-8-6-18(7-9-21)16-25-22(29)14-17-10-12-28(13-11-17)23(30)26-20-5-3-4-19(24)15-20/h3-9,15,17H,10-14,16H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | IYZFAIQHGPYFTC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|