C19H22ClN3O2 — CID 53151028
N-(3-chlorophenyl)-4-(2-pyridin-3-yloxyethyl)piperidine-1-carboxamide (PubChem CID 53151028) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-(2-pyridin-3-yloxyethyl)piperidine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-(2-pyridin-3-yloxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 53151028 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | N-(3-chlorophenyl)-4-(2-pyridin-3-yloxyethyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCC(CCOc2cccnc2)CC1 |
| InChI | InChI=1S/C19H22ClN3O2/c20-16-3-1-4-17(13-16)22-19(24)23-10-6-15(7-11-23)8-12-25-18-5-2-9-21-14-18/h1-5,9,13-15H,6-8,10-12H2,(H,22,24) |
| InChIKey | NVVHLJUVBNZBFU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |