About carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum
carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum (PubChem CID 162490671) has the molecular formula C21H17N2Pt-3
and a molecular weight of 492.46 g/mol. Its IUPAC name is carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum.
Molecular Properties
| Compound Name | carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum |
| PubChem CID | 162490671 |
| Molecular Formula | C21H17N2Pt-3 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum |
| SMILES | [CH3-].[Pt].[c-]1ccccc1/C=N\c1ccccc1/N=C/c1[c-]cccc1 |
| InChI | InChI=1S/C20H14N2.CH3.Pt/c1-3-9-17(10-4-1)15-21-19-13-7-8-14-20(19)22-16-18-11-5-2-6-12-18;;/h1-9,11,13-16H;1H3;/q-2;-1;/b21-15-,22-16+;; |
| InChIKey | XMCIFLBDYRUGRB-ZKWTVRRCSA-N |
| XLogP | 5.24 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum?
The IUPAC name of carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum (CID 162490671) is carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum.
What is the SMILES notation for carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum?
The canonical SMILES for carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum is [CH3-].[Pt].[c-]1ccccc1/C=N\c1ccccc1/N=C/c1[c-]cccc1.
What is the InChIKey of carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum?
The InChIKey is XMCIFLBDYRUGRB-ZKWTVRRCSA-N. The full InChI is InChI=1S/C20H14N2.CH3.Pt/c1-3-9-17(10-4-1)15-21-19-13-7-8-14-20(19)22-16-18-11-5-2-6-12-18;;/h1-9,11,13-16H;1H3;/q-2;-1;/b21-15-,22-16+;;.
What are the key properties of carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum?
carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum has a molecular weight of 492.46 g/mol, XLogP of 5.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;1-phenyl-N-[2-(phenylmethylideneamino)phenyl]methanimine;platinum is sourced from PubChem (CID 162490671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).