C18H15F3N6O3S — CID 162491487
6-isocyano-3-[2-methylsulfonyl-5-(trifluoromethyl)pyrimidin-4-yl]-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine (PubChem CID 162491487) has the molecular formula C18H15F3N6O3S and a molecular weight of 452.42 g/mol. Its IUPAC name is 6-isocyano-3-[2-methylsulfonyl-5-(trifluoromethyl)pyrimidin-4-yl]-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine.
| Compound Name | 6-isocyano-3-[2-methylsulfonyl-5-(trifluoromethyl)pyrimidin-4-yl]-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 162491487 |
| Molecular Formula | C18H15F3N6O3S |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 6-isocyano-3-[2-methylsulfonyl-5-(trifluoromethyl)pyrimidin-4-yl]-1-(oxan-2-yl)pyrazolo[5,4-b]pyridine |
| SMILES | [C-]#[N+]c1ccc2c(-c3nc(S(C)(=O)=O)ncc3C(F)(F)F)nn(C3CCCCO3)c2n1 |
| InChI | InChI=1S/C18H15F3N6O3S/c1-22-12-7-6-10-14(26-27(16(10)24-12)13-5-3-4-8-30-13)15-11(18(19,20)21)9-23-17(25-15)31(2,28)29/h6-7,9,13H,3-5,8H2,2H3 |
| InChIKey | IWRMEXKRVHADOJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 104.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|