C19H24ClN3O3 — CID 162493560
tert-butyl 7-(3-chloro-2-isocyano-5-methoxyphenyl)-2,7-diazaspiro[3.4]octane-2-carboxylate (PubChem CID 162493560) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is tert-butyl 7-(3-chloro-2-isocyano-5-methoxyphenyl)-2,7-diazaspiro[3.4]octane-2-carboxylate.
| Compound Name | tert-butyl 7-(3-chloro-2-isocyano-5-methoxyphenyl)-2,7-diazaspiro[3.4]octane-2-carboxylate |
|---|---|
| PubChem CID | 162493560 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | tert-butyl 7-(3-chloro-2-isocyano-5-methoxyphenyl)-2,7-diazaspiro[3.4]octane-2-carboxylate |
| SMILES | [C-]#[N+]c1c(Cl)cc(OC)cc1N1CCC2(CN(C(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-18(2,3)26-17(24)23-11-19(12-23)6-7-22(10-19)15-9-13(25-5)8-14(20)16(15)21-4/h8-9H,6-7,10-12H2,1-3,5H3 |
| InChIKey | WQFIYEVVOIZBLC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|