C26H26F3N3O — CID 162493579
3-amino-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-propan-2-yl-4-[3-(trifluoromethyl)anilino]benzamide (PubChem CID 162493579) has the molecular formula C26H26F3N3O and a molecular weight of 453.51 g/mol. Its IUPAC name is 3-amino-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-propan-2-yl-4-[3-(trifluoromethyl)anilino]benzamide.
| Compound Name | 3-amino-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-propan-2-yl-4-[3-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 162493579 |
| Molecular Formula | C26H26F3N3O |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 3-amino-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-2-propan-2-yl-4-[3-(trifluoromethyl)anilino]benzamide |
| SMILES | CC(C)c1c(C(=O)N[C@H]2CCc3ccccc32)ccc(Nc2cccc(C(F)(F)F)c2)c1N |
| InChI | InChI=1S/C26H26F3N3O/c1-15(2)23-20(25(33)32-21-12-10-16-6-3-4-9-19(16)21)11-13-22(24(23)30)31-18-8-5-7-17(14-18)26(27,28)29/h3-9,11,13-15,21,31H,10,12,30H2,1-2H3,(H,32,33)/t21-/m0/s1 |
| InChIKey | QTNOVZDWKABGNH-NRFANRHFSA-N |
| XLogP | 6.57 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|