C9H6BrF3N2O5 — CID 162494162
methyl 2-[(6-bromo-3-nitro-2-pyridinyl)oxy]-3,3,3-trifluoropropanoate (PubChem CID 162494162) has the molecular formula C9H6BrF3N2O5 and a molecular weight of 359.05 g/mol. Its IUPAC name is methyl 2-[(6-bromo-3-nitro-2-pyridinyl)oxy]-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-[(6-bromo-3-nitro-2-pyridinyl)oxy]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 162494162 |
| Molecular Formula | C9H6BrF3N2O5 |
| Molecular Weight | 359.05 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | methyl 2-[(6-bromo-3-nitro-2-pyridinyl)oxy]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(Oc1nc(Br)ccc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C9H6BrF3N2O5/c1-19-8(16)6(9(11,12)13)20-7-4(15(17)18)2-3-5(10)14-7/h2-3,6H,1H3 |
| InChIKey | MYHNSBWMCJZHFB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.05 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|