C21H15ClFN3O2 — CID 162495443
2-[2-chloro-4-(hydroxymethyl)anilino]-6-fluoro-3-phenylquinazolin-4-one (PubChem CID 162495443) has the molecular formula C21H15ClFN3O2 and a molecular weight of 395.82 g/mol. Its IUPAC name is 2-[2-chloro-4-(hydroxymethyl)anilino]-6-fluoro-3-phenylquinazolin-4-one.
| Compound Name | 2-[2-chloro-4-(hydroxymethyl)anilino]-6-fluoro-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 162495443 |
| Molecular Formula | C21H15ClFN3O2 |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-[2-chloro-4-(hydroxymethyl)anilino]-6-fluoro-3-phenylquinazolin-4-one |
| SMILES | O=c1c2cc(F)ccc2nc(Nc2ccc(CO)cc2Cl)n1-c1ccccc1 |
| InChI | InChI=1S/C21H15ClFN3O2/c22-17-10-13(12-27)6-8-19(17)25-21-24-18-9-7-14(23)11-16(18)20(28)26(21)15-4-2-1-3-5-15/h1-11,27H,12H2,(H,24,25) |
| InChIKey | DMCYTQODIZVLTN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |