C14H20O — CID 162497752
(4R)-3-methyl-2-[(2Z)-penta-2,4-dienyl]-4-propan-2-ylcyclopent-2-en-1-one (PubChem CID 162497752) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (4R)-3-methyl-2-[(2Z)-penta-2,4-dienyl]-4-propan-2-ylcyclopent-2-en-1-one.
| Compound Name | (4R)-3-methyl-2-[(2Z)-penta-2,4-dienyl]-4-propan-2-ylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 162497752 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (4R)-3-methyl-2-[(2Z)-penta-2,4-dienyl]-4-propan-2-ylcyclopent-2-en-1-one |
| SMILES | C=C/C=C\CC1=C(C)[C@@H](C(C)C)CC1=O |
| InChI | InChI=1S/C14H20O/c1-5-6-7-8-12-11(4)13(10(2)3)9-14(12)15/h5-7,10,13H,1,8-9H2,2-4H3/b7-6-/t13-/m1/s1 |
| InChIKey | OWKABDDETNFRFY-FMFIFOJESA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|