C31H24Cl2F3NO3 — CID 162499047
(1-anthracen-9-yl-2,2,2-trifluoroethyl) 2-[3-[(3,4-dichlorobenzoyl)amino]-1-bicyclo[1.1.1]pentanyl]propanoate (PubChem CID 162499047) has the molecular formula C31H24Cl2F3NO3 and a molecular weight of 586.44 g/mol. Its IUPAC name is (1-anthracen-9-yl-2,2,2-trifluoroethyl) 2-[3-[(3,4-dichlorobenzoyl)amino]-1-bicyclo[1.1.1]pentanyl]propanoate.
| Compound Name | (1-anthracen-9-yl-2,2,2-trifluoroethyl) 2-[3-[(3,4-dichlorobenzoyl)amino]-1-bicyclo[1.1.1]pentanyl]propanoate |
|---|---|
| PubChem CID | 162499047 |
| Molecular Formula | C31H24Cl2F3NO3 |
| Molecular Weight | 586.44 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | (1-anthracen-9-yl-2,2,2-trifluoroethyl) 2-[3-[(3,4-dichlorobenzoyl)amino]-1-bicyclo[1.1.1]pentanyl]propanoate |
| SMILES | CC(C(=O)OC(c1c2ccccc2cc2ccccc12)C(F)(F)F)C12CC(NC(=O)c3ccc(Cl)c(Cl)c3)(C1)C2 |
| InChI | InChI=1S/C31H24Cl2F3NO3/c1-17(29-14-30(15-29,16-29)37-27(38)20-10-11-23(32)24(33)13-20)28(39)40-26(31(34,35)36)25-21-8-4-2-6-18(21)12-19-7-3-5-9-22(19)25/h2-13,17,26H,14-16H2,1H3,(H,37,38) |
| InChIKey | GGUYQMKOYCHUJA-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.44 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|