C47H38BN3OPt-2 — CID 162500062
[1-[3-[[3-[(4-tert-butyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-(2,6-diphenylphenyl)boranyl]benzene-2-id-1-yl]-3-methylbenzimidazol-2-ylidene]platinum (PubChem CID 162500062) has the molecular formula C47H38BN3OPt-2 and a molecular weight of 866.73 g/mol. Its IUPAC name is [1-[3-[[3-[(4-tert-butyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-(2,6-diphenylphenyl)boranyl]benzene-2-id-1-yl]-3-methylbenzimidazol-2-ylidene]platinum.
| Compound Name | [1-[3-[[3-[(4-tert-butyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-(2,6-diphenylphenyl)boranyl]benzene-2-id-1-yl]-3-methylbenzimidazol-2-ylidene]platinum |
|---|---|
| PubChem CID | 162500062 |
| Molecular Formula | C47H38BN3OPt-2 |
| Molecular Weight | 866.73 g/mol |
| Exact Mass | 866.28 |
| IUPAC Name | [1-[3-[[3-[(4-tert-butyl-2-pyridinyl)oxy]benzene-2-id-1-yl]-(2,6-diphenylphenyl)boranyl]benzene-2-id-1-yl]-3-methylbenzimidazol-2-ylidene]platinum |
| SMILES | Cn1c(=[Pt])n(-c2[c-]c(B(c3[c-]c(Oc4cc(C(C)(C)C)ccn4)ccc3)c3c(-c4ccccc4)cccc3-c3ccccc3)ccc2)c2ccccc21 |
| InChI | InChI=1S/C47H38BN3O.Pt/c1-47(2,3)36-28-29-49-45(30-36)52-40-23-14-21-38(32-40)48(37-20-13-22-39(31-37)51-33-50(4)43-26-11-12-27-44(43)51)46-41(34-16-7-5-8-17-34)24-15-25-42(46)35-18-9-6-10-19-35;/h5-30H,1-4H3;/q-2; |
| InChIKey | CUUWSIZVZZFYBC-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.73 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|