C46H36BN3Pt-2 — CID 162500097
[1-[3-[(2,6-diphenylphenyl)-[3-(2-pyridin-2-ylpropan-2-yl)benzene-2-id-1-yl]boranyl]benzene-2-id-1-yl]-3-methylbenzimidazol-2-ylidene]platinum (PubChem CID 162500097) has the molecular formula C46H36BN3Pt-2 and a molecular weight of 836.71 g/mol. Its IUPAC name is [1-[3-[(2,6-diphenylphenyl)-[3-(2-pyridin-2-ylpropan-2-yl)benzene-2-id-1-yl]boranyl]benzene-2-id-1-yl]-3-methylbenzimidazol-2-ylidene]platinum.
| Compound Name | [1-[3-[(2,6-diphenylphenyl)-[3-(2-pyridin-2-ylpropan-2-yl)benzene-2-id-1-yl]boranyl]benzene-2-id-1-yl]-3-methylbenzimidazol-2-ylidene]platinum |
|---|---|
| PubChem CID | 162500097 |
| Molecular Formula | C46H36BN3Pt-2 |
| Molecular Weight | 836.71 g/mol |
| Exact Mass | 836.27 |
| IUPAC Name | [1-[3-[(2,6-diphenylphenyl)-[3-(2-pyridin-2-ylpropan-2-yl)benzene-2-id-1-yl]boranyl]benzene-2-id-1-yl]-3-methylbenzimidazol-2-ylidene]platinum |
| SMILES | Cn1c(=[Pt])n(-c2[c-]c(B(c3[c-]c(C(C)(C)c4ccccn4)ccc3)c3c(-c4ccccc4)cccc3-c3ccccc3)ccc2)c2ccccc21 |
| InChI | InChI=1S/C46H36BN3.Pt/c1-46(2,44-29-12-13-30-48-44)36-21-14-22-37(31-36)47(38-23-15-24-39(32-38)50-33-49(3)42-27-10-11-28-43(42)50)45-40(34-17-6-4-7-18-34)25-16-26-41(45)35-19-8-5-9-20-35;/h4-30H,1-3H3;/q-2; |
| InChIKey | MWAILXABBHNAQS-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.71 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|