C49H36BN3Pt — CID 162500130
[1-[3-[(2,6-diphenylphenyl)-(3-pyridin-2-ylphenyl)boranyl]phenyl]-3-(4-methylphenyl)benzimidazol-2-ylidene]platinum (PubChem CID 162500130) has the molecular formula C49H36BN3Pt and a molecular weight of 872.74 g/mol. Its IUPAC name is [1-[3-[(2,6-diphenylphenyl)-(3-pyridin-2-ylphenyl)boranyl]phenyl]-3-(4-methylphenyl)benzimidazol-2-ylidene]platinum.
| Compound Name | [1-[3-[(2,6-diphenylphenyl)-(3-pyridin-2-ylphenyl)boranyl]phenyl]-3-(4-methylphenyl)benzimidazol-2-ylidene]platinum |
|---|---|
| PubChem CID | 162500130 |
| Molecular Formula | C49H36BN3Pt |
| Molecular Weight | 872.74 g/mol |
| Exact Mass | 872.27 |
| IUPAC Name | [1-[3-[(2,6-diphenylphenyl)-(3-pyridin-2-ylphenyl)boranyl]phenyl]-3-(4-methylphenyl)benzimidazol-2-ylidene]platinum |
| SMILES | Cc1ccc(-n2c(=[Pt])n(-c3cccc(B(c4cccc(-c5ccccn5)c4)c4c(-c5ccccc5)cccc4-c4ccccc4)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C49H36BN3.Pt/c1-36-28-30-42(31-29-36)52-35-53(48-27-9-8-26-47(48)52)43-22-13-21-41(34-43)50(40-20-12-19-39(33-40)46-25-10-11-32-51-46)49-44(37-15-4-2-5-16-37)23-14-24-45(49)38-17-6-3-7-18-38;/h2-34H,1H3; |
| InChIKey | IRJYHRLNKUXRNC-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.74 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|