C52H42BN3Pt — CID 162500071
[1-(4-tert-butylphenyl)-3-[3-[(2,6-diphenylphenyl)-(3-pyridin-2-ylphenyl)boranyl]phenyl]benzimidazol-2-ylidene]platinum (PubChem CID 162500071) has the molecular formula C52H42BN3Pt and a molecular weight of 914.82 g/mol. Its IUPAC name is [1-(4-tert-butylphenyl)-3-[3-[(2,6-diphenylphenyl)-(3-pyridin-2-ylphenyl)boranyl]phenyl]benzimidazol-2-ylidene]platinum.
| Compound Name | [1-(4-tert-butylphenyl)-3-[3-[(2,6-diphenylphenyl)-(3-pyridin-2-ylphenyl)boranyl]phenyl]benzimidazol-2-ylidene]platinum |
|---|---|
| PubChem CID | 162500071 |
| Molecular Formula | C52H42BN3Pt |
| Molecular Weight | 914.82 g/mol |
| Exact Mass | 914.31 |
| IUPAC Name | [1-(4-tert-butylphenyl)-3-[3-[(2,6-diphenylphenyl)-(3-pyridin-2-ylphenyl)boranyl]phenyl]benzimidazol-2-ylidene]platinum |
| SMILES | CC(C)(C)c1ccc(-n2c(=[Pt])n(-c3cccc(B(c4cccc(-c5ccccn5)c4)c4c(-c5ccccc5)cccc4-c4ccccc4)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C52H42BN3.Pt/c1-52(2,3)41-30-32-44(33-31-41)55-37-56(50-29-11-10-28-49(50)55)45-24-15-23-43(36-45)53(42-22-14-21-40(35-42)48-27-12-13-34-54-48)51-46(38-17-6-4-7-18-38)25-16-26-47(51)39-19-8-5-9-20-39;/h4-36H,1-3H3; |
| InChIKey | FAWZDZMMRYOULK-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.82 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|