C36H37BN2 — CID 140800998
(3,5-ditert-butylphenyl)-(6-phenyl-2-pyridinyl)-(3-pyridin-2-ylphenyl)borane (PubChem CID 140800998) has the molecular formula C36H37BN2 and a molecular weight of 508.52 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl)-(6-phenyl-2-pyridinyl)-(3-pyridin-2-ylphenyl)borane.
| Compound Name | (3,5-ditert-butylphenyl)-(6-phenyl-2-pyridinyl)-(3-pyridin-2-ylphenyl)borane |
|---|---|
| PubChem CID | 140800998 |
| Molecular Formula | C36H37BN2 |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | (3,5-ditert-butylphenyl)-(6-phenyl-2-pyridinyl)-(3-pyridin-2-ylphenyl)borane |
| SMILES | CC(C)(C)c1cc(B(c2cccc(-c3ccccn3)c2)c2cccc(-c3ccccc3)n2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H37BN2/c1-35(2,3)28-23-29(36(4,5)6)25-31(24-28)37(30-17-12-16-27(22-30)32-18-10-11-21-38-32)34-20-13-19-33(39-34)26-14-8-7-9-15-26/h7-25H,1-6H3 |
| InChIKey | OFFFJFVDJFGVLE-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|