C53H33N3 — CID 162506961
2-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[10-(4-pyridin-2-ylphenyl)anthracen-9-yl]naphthalen-1-yl]-1,10-phenanthroline (PubChem CID 162506961) has the molecular formula C53H33N3 and a molecular weight of 716.90 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[10-(4-pyridin-2-ylphenyl)anthracen-9-yl]naphthalen-1-yl]-1,10-phenanthroline.
| Compound Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[10-(4-pyridin-2-ylphenyl)anthracen-9-yl]naphthalen-1-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 162506961 |
| Molecular Formula | C53H33N3 |
| Molecular Weight | 716.90 g/mol |
| Exact Mass | 716.30 |
| IUPAC Name | 2-(2,3,4,5,6-pentadeuteriophenyl)-9-[4-[10-(4-pyridin-2-ylphenyl)anthracen-9-yl]naphthalen-1-yl]-1,10-phenanthroline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3ccc4ccc(-c5ccc(-c6c7ccccc7c(-c7ccc(-c8ccccn8)cc7)c7ccccc67)c6ccccc56)nc4c3n2)c([2H])c1[2H] |
| InChI | InChI=1S/C53H33N3/c1-2-12-34(13-3-1)48-31-27-37-25-26-38-28-32-49(56-53(38)52(37)55-48)41-29-30-46(40-15-5-4-14-39(40)41)51-44-18-8-6-16-42(44)50(43-17-7-9-19-45(43)51)36-23-21-35(22-24-36)47-20-10-11-33-54-47/h1-33H/i1D,2D,3D,12D,13D |
| InChIKey | RRUPMLAXLFWXDY-AYAICNHJSA-N |
| XLogP | 13.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.90 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|