C35H23N — CID 176646872
2-[4-(1,4,5,8-tetradeuterio-10-naphthalen-1-ylanthracen-9-yl)phenyl]pyridine (PubChem CID 176646872) has the molecular formula C35H23N and a molecular weight of 461.60 g/mol. Its IUPAC name is 2-[4-(1,4,5,8-tetradeuterio-10-naphthalen-1-ylanthracen-9-yl)phenyl]pyridine.
| Compound Name | 2-[4-(1,4,5,8-tetradeuterio-10-naphthalen-1-ylanthracen-9-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 176646872 |
| Molecular Formula | C35H23N |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 2-[4-(1,4,5,8-tetradeuterio-10-naphthalen-1-ylanthracen-9-yl)phenyl]pyridine |
| SMILES | [2H]c1ccc([2H])c2c(-c3cccc4ccccc34)c3c([2H])ccc([2H])c3c(-c3ccc(-c4ccccn4)cc3)c12 |
| InChI | InChI=1S/C35H23N/c1-2-12-27-24(10-1)11-9-17-28(27)35-31-15-5-3-13-29(31)34(30-14-4-6-16-32(30)35)26-21-19-25(20-22-26)33-18-7-8-23-36-33/h1-23H/i13D,14D,15D,16D |
| InChIKey | GUWGVTGAMQAQEY-DNXUXHMQSA-N |
| XLogP | 9.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|