C11H17Br2NO4 — CID 162508388
2-(2,2-dibromoacetyl)oxyethyl 3-aminocyclohexane-1-carboxylate (PubChem CID 162508388) has the molecular formula C11H17Br2NO4 and a molecular weight of 387.07 g/mol. Its IUPAC name is 2-(2,2-dibromoacetyl)oxyethyl 3-aminocyclohexane-1-carboxylate.
| Compound Name | 2-(2,2-dibromoacetyl)oxyethyl 3-aminocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 162508388 |
| Molecular Formula | C11H17Br2NO4 |
| Molecular Weight | 387.07 g/mol |
| Exact Mass | 384.95 |
| IUPAC Name | 2-(2,2-dibromoacetyl)oxyethyl 3-aminocyclohexane-1-carboxylate |
| SMILES | NC1CCCC(C(=O)OCCOC(=O)C(Br)Br)C1 |
| InChI | InChI=1S/C11H17Br2NO4/c12-9(13)11(16)18-5-4-17-10(15)7-2-1-3-8(14)6-7/h7-9H,1-6,14H2 |
| InChIKey | ONELEKWPRXMODA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.07 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|