C10H15Br2NO4 — CID 162508841
2-(2,2-dibromoacetyl)oxyethyl piperidine-4-carboxylate (PubChem CID 162508841) has the molecular formula C10H15Br2NO4 and a molecular weight of 373.04 g/mol. Its IUPAC name is 2-(2,2-dibromoacetyl)oxyethyl piperidine-4-carboxylate.
| Compound Name | 2-(2,2-dibromoacetyl)oxyethyl piperidine-4-carboxylate |
|---|---|
| PubChem CID | 162508841 |
| Molecular Formula | C10H15Br2NO4 |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 2-(2,2-dibromoacetyl)oxyethyl piperidine-4-carboxylate |
| SMILES | O=C(OCCOC(=O)C1CCNCC1)C(Br)Br |
| InChI | InChI=1S/C10H15Br2NO4/c11-8(12)10(15)17-6-5-16-9(14)7-1-3-13-4-2-7/h7-8,13H,1-6H2 |
| InChIKey | OGAYHEITICYVSP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|